C18H20N2 — CID 171213067
(R)-cyclopropyl-(9-ethylcarbazol-3-yl)methanamine (PubChem CID 171213067) has the molecular formula C18H20N2 and a molecular weight of 264.37 g/mol. Its IUPAC name is (R)-cyclopropyl-(9-ethylcarbazol-3-yl)methanamine.
| Compound Name | (R)-cyclopropyl-(9-ethylcarbazol-3-yl)methanamine |
|---|---|
| PubChem CID | 171213067 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | (R)-cyclopropyl-(9-ethylcarbazol-3-yl)methanamine |
| SMILES | CCn1c2ccccc2c2cc([C@H](N)C3CC3)ccc21 |
| InChI | InChI=1S/C18H20N2/c1-2-20-16-6-4-3-5-14(16)15-11-13(9-10-17(15)20)18(19)12-7-8-12/h3-6,9-12,18H,2,7-8,19H2,1H3/t18-/m1/s1 |
| InChIKey | CGYQVUPZJHKHGP-GOSISDBHSA-N |
| XLogP | 4.22 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |