C23H31Cl2N3 — CID 171282180
3-[(S)-cyclobutyl(piperazin-1-yl)methyl]-9-ethylcarbazole;dihydrochloride (PubChem CID 171282180) has the molecular formula C23H31Cl2N3 and a molecular weight of 420.43 g/mol. Its IUPAC name is 3-[(S)-cyclobutyl(piperazin-1-yl)methyl]-9-ethylcarbazole;dihydrochloride.
| Compound Name | 3-[(S)-cyclobutyl(piperazin-1-yl)methyl]-9-ethylcarbazole;dihydrochloride |
|---|---|
| PubChem CID | 171282180 |
| Molecular Formula | C23H31Cl2N3 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 3-[(S)-cyclobutyl(piperazin-1-yl)methyl]-9-ethylcarbazole;dihydrochloride |
| SMILES | CCn1c2ccccc2c2cc([C@H](C3CCC3)N3CCNCC3)ccc21.Cl.Cl |
| InChI | InChI=1S/C23H29N3.2ClH/c1-2-26-21-9-4-3-8-19(21)20-16-18(10-11-22(20)26)23(17-6-5-7-17)25-14-12-24-13-15-25;;/h3-4,8-11,16-17,23-24H,2,5-7,12-15H2,1H3;2*1H/t23-;;/m0../s1 |
| InChIKey | CBAMTASTLXJXRD-IFUPQEAVSA-N |
| XLogP | 5.40 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |