C23H31Cl2N3 — CID 171294822
9-ethyl-3-[(1R)-3-methyl-1-piperazin-1-ylbut-3-enyl]carbazole;dihydrochloride (PubChem CID 171294822) has the molecular formula C23H31Cl2N3 and a molecular weight of 420.43 g/mol. Its IUPAC name is 9-ethyl-3-[(1R)-3-methyl-1-piperazin-1-ylbut-3-enyl]carbazole;dihydrochloride.
| Compound Name | 9-ethyl-3-[(1R)-3-methyl-1-piperazin-1-ylbut-3-enyl]carbazole;dihydrochloride |
|---|---|
| PubChem CID | 171294822 |
| Molecular Formula | C23H31Cl2N3 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 9-ethyl-3-[(1R)-3-methyl-1-piperazin-1-ylbut-3-enyl]carbazole;dihydrochloride |
| SMILES | C=C(C)C[C@H](c1ccc2c(c1)c1ccccc1n2CC)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C23H29N3.2ClH/c1-4-26-21-8-6-5-7-19(21)20-16-18(9-10-22(20)26)23(15-17(2)3)25-13-11-24-12-14-25;;/h5-10,16,23-24H,2,4,11-15H2,1,3H3;2*1H/t23-;;/m1../s1 |
| InChIKey | FQHQZDMBNMNXAV-MQWQBNKOSA-N |
| XLogP | 5.57 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|