C22H27N3 — CID 171294795
9-ethyl-3-[(1R)-1-piperazin-1-ylbut-3-enyl]carbazole (PubChem CID 171294795) has the molecular formula C22H27N3 and a molecular weight of 333.48 g/mol. Its IUPAC name is 9-ethyl-3-[(1R)-1-piperazin-1-ylbut-3-enyl]carbazole.
| Compound Name | 9-ethyl-3-[(1R)-1-piperazin-1-ylbut-3-enyl]carbazole |
|---|---|
| PubChem CID | 171294795 |
| Molecular Formula | C22H27N3 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | 9-ethyl-3-[(1R)-1-piperazin-1-ylbut-3-enyl]carbazole |
| SMILES | C=CC[C@H](c1ccc2c(c1)c1ccccc1n2CC)N1CCNCC1 |
| InChI | InChI=1S/C22H27N3/c1-3-7-20(24-14-12-23-13-15-24)17-10-11-22-19(16-17)18-8-5-6-9-21(18)25(22)4-2/h3,5-6,8-11,16,20,23H,1,4,7,12-15H2,2H3/t20-/m1/s1 |
| InChIKey | AZJZURSYISBBRG-HXUWFJFHSA-N |
| XLogP | 4.34 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|