C21H26N2O — CID 171264885
(1S,2R)-2-amino-1-cyclopentyl-2-(9-ethylcarbazol-3-yl)ethanol (PubChem CID 171264885) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is (1S,2R)-2-amino-1-cyclopentyl-2-(9-ethylcarbazol-3-yl)ethanol.
| Compound Name | (1S,2R)-2-amino-1-cyclopentyl-2-(9-ethylcarbazol-3-yl)ethanol |
|---|---|
| PubChem CID | 171264885 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (1S,2R)-2-amino-1-cyclopentyl-2-(9-ethylcarbazol-3-yl)ethanol |
| SMILES | CCn1c2ccccc2c2cc([C@@H](N)[C@@H](O)C3CCCC3)ccc21 |
| InChI | InChI=1S/C21H26N2O/c1-2-23-18-10-6-5-9-16(18)17-13-15(11-12-19(17)23)20(22)21(24)14-7-3-4-8-14/h5-6,9-14,20-21,24H,2-4,7-8,22H2,1H3/t20-,21+/m1/s1 |
| InChIKey | IMTSJRIHKIZOAL-RTWAWAEBSA-N |
| XLogP | 4.37 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |