About (S)-(6-bromo-1,3-benzodioxol-5-yl)-thiophen-2-ylmethanamine;hydrochloride
(S)-(6-bromo-1,3-benzodioxol-5-yl)-thiophen-2-ylmethanamine;hydrochloride (PubChem CID 171213203) has the molecular formula C12H11BrClNO2S
and a molecular weight of 348.65 g/mol. Its IUPAC name is (S)-(6-bromo-1,3-benzodioxol-5-yl)-thiophen-2-ylmethanamine;hydrochloride.
Molecular Properties
| Compound Name | (S)-(6-bromo-1,3-benzodioxol-5-yl)-thiophen-2-ylmethanamine;hydrochloride |
| PubChem CID | 171213203 |
| Molecular Formula | C12H11BrClNO2S |
| Molecular Weight | 348.65 g/mol |
| Exact Mass | 346.94 |
| IUPAC Name | (S)-(6-bromo-1,3-benzodioxol-5-yl)-thiophen-2-ylmethanamine;hydrochloride |
| SMILES | Cl.N[C@H](c1cccs1)c1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C12H10BrNO2S.ClH/c13-8-5-10-9(15-6-16-10)4-7(8)12(14)11-2-1-3-17-11;/h1-5,12H,6,14H2;1H/t12-;/m0./s1 |
| InChIKey | WLGSZMWUTOQYPG-YDALLXLXSA-N |
| XLogP | 3.71 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.65 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (S)-(6-bromo-1,3-benzodioxol-5-yl)-thiophen-2-ylmethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (S)-(6-bromo-1,3-benzodioxol-5-yl)-thiophen-2-ylmethanamine;hydrochloride?
The IUPAC name of (S)-(6-bromo-1,3-benzodioxol-5-yl)-thiophen-2-ylmethanamine;hydrochloride (CID 171213203) is (S)-(6-bromo-1,3-benzodioxol-5-yl)-thiophen-2-ylmethanamine;hydrochloride.
What is the SMILES notation for (S)-(6-bromo-1,3-benzodioxol-5-yl)-thiophen-2-ylmethanamine;hydrochloride?
The canonical SMILES for (S)-(6-bromo-1,3-benzodioxol-5-yl)-thiophen-2-ylmethanamine;hydrochloride is Cl.N[C@H](c1cccs1)c1cc2c(cc1Br)OCO2.
What is the InChIKey of (S)-(6-bromo-1,3-benzodioxol-5-yl)-thiophen-2-ylmethanamine;hydrochloride?
The InChIKey is WLGSZMWUTOQYPG-YDALLXLXSA-N. The full InChI is InChI=1S/C12H10BrNO2S.ClH/c13-8-5-10-9(15-6-16-10)4-7(8)12(14)11-2-1-3-17-11;/h1-5,12H,6,14H2;1H/t12-;/m0./s1.
What are the key properties of (S)-(6-bromo-1,3-benzodioxol-5-yl)-thiophen-2-ylmethanamine;hydrochloride?
(S)-(6-bromo-1,3-benzodioxol-5-yl)-thiophen-2-ylmethanamine;hydrochloride has a molecular weight of 348.65 g/mol, XLogP of 3.71, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (S)-(6-bromo-1,3-benzodioxol-5-yl)-thiophen-2-ylmethanamine;hydrochloride is sourced from PubChem (CID 171213203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).