C16H16ClNS — CID 171215096
(R)-[2-(4-chlorophenyl)sulfanylphenyl]-cyclopropylmethanamine (PubChem CID 171215096) has the molecular formula C16H16ClNS and a molecular weight of 289.83 g/mol. Its IUPAC name is (R)-[2-(4-chlorophenyl)sulfanylphenyl]-cyclopropylmethanamine.
| Compound Name | (R)-[2-(4-chlorophenyl)sulfanylphenyl]-cyclopropylmethanamine |
|---|---|
| PubChem CID | 171215096 |
| Molecular Formula | C16H16ClNS |
| Molecular Weight | 289.83 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | (R)-[2-(4-chlorophenyl)sulfanylphenyl]-cyclopropylmethanamine |
| SMILES | N[C@@H](c1ccccc1Sc1ccc(Cl)cc1)C1CC1 |
| InChI | InChI=1S/C16H16ClNS/c17-12-7-9-13(10-8-12)19-15-4-2-1-3-14(15)16(18)11-5-6-11/h1-4,7-11,16H,5-6,18H2/t16-/m1/s1 |
| InChIKey | BJALWCKCAOYHND-MRXNPFEDSA-N |
| XLogP | 4.90 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.83 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |