C17H20ClNOS — CID 171265664
(1R,2S)-1-amino-1-[2-(4-chlorophenyl)sulfanylphenyl]pentan-2-ol (PubChem CID 171265664) has the molecular formula C17H20ClNOS and a molecular weight of 321.87 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-[2-(4-chlorophenyl)sulfanylphenyl]pentan-2-ol.
| Compound Name | (1R,2S)-1-amino-1-[2-(4-chlorophenyl)sulfanylphenyl]pentan-2-ol |
|---|---|
| PubChem CID | 171265664 |
| Molecular Formula | C17H20ClNOS |
| Molecular Weight | 321.87 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (1R,2S)-1-amino-1-[2-(4-chlorophenyl)sulfanylphenyl]pentan-2-ol |
| SMILES | CCC[C@H](O)[C@H](N)c1ccccc1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H20ClNOS/c1-2-5-15(20)17(19)14-6-3-4-7-16(14)21-13-10-8-12(18)9-11-13/h3-4,6-11,15,17,20H,2,5,19H2,1H3/t15-,17+/m0/s1 |
| InChIKey | KDUVPSLIELANNK-DOTOQJQBSA-N |
| XLogP | 4.65 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.87 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |