C17H15N3O5 — CID 17121892
N-(4-methyl-3-nitrophenyl)-2-(2-oxo-3,4-dihydro-1,4-benzoxazin-3-yl)acetamide (PubChem CID 17121892) has the molecular formula C17H15N3O5 and a molecular weight of 341.32 g/mol. Its IUPAC name is N-(4-methyl-3-nitrophenyl)-2-(2-oxo-3,4-dihydro-1,4-benzoxazin-3-yl)acetamide.
| Compound Name | N-(4-methyl-3-nitrophenyl)-2-(2-oxo-3,4-dihydro-1,4-benzoxazin-3-yl)acetamide |
|---|---|
| PubChem CID | 17121892 |
| Molecular Formula | C17H15N3O5 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-(4-methyl-3-nitrophenyl)-2-(2-oxo-3,4-dihydro-1,4-benzoxazin-3-yl)acetamide |
| SMILES | Cc1ccc(NC(=O)CC2Nc3ccccc3OC2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H15N3O5/c1-10-6-7-11(8-14(10)20(23)24)18-16(21)9-13-17(22)25-15-5-3-2-4-12(15)19-13/h2-8,13,19H,9H2,1H3,(H,18,21) |
| InChIKey | ZIURIROYTOPBPL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|