C18H18N2O3 — CID 41452841
N-(2,5-dimethylphenyl)-2-[(3S)-2-oxo-3,4-dihydro-1,4-benzoxazin-3-yl]acetamide (PubChem CID 41452841) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-[(3S)-2-oxo-3,4-dihydro-1,4-benzoxazin-3-yl]acetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-[(3S)-2-oxo-3,4-dihydro-1,4-benzoxazin-3-yl]acetamide |
|---|---|
| PubChem CID | 41452841 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-[(3S)-2-oxo-3,4-dihydro-1,4-benzoxazin-3-yl]acetamide |
| SMILES | Cc1ccc(C)c(NC(=O)C[C@@H]2Nc3ccccc3OC2=O)c1 |
| InChI | InChI=1S/C18H18N2O3/c1-11-7-8-12(2)14(9-11)20-17(21)10-15-18(22)23-16-6-4-3-5-13(16)19-15/h3-9,15,19H,10H2,1-2H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | NYOZFYLBRGCXAQ-HNNXBMFYSA-N |
| XLogP | 3.03 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|