C14H16N4O4 — CID 17122173
2-O-[2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl] 1-O-ethyl oxalate (PubChem CID 17122173) has the molecular formula C14H16N4O4 and a molecular weight of 304.31 g/mol. Its IUPAC name is 2-O-[2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl] 1-O-ethyl oxalate.
| Compound Name | 2-O-[2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl] 1-O-ethyl oxalate |
|---|---|
| PubChem CID | 17122173 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-O-[2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl] 1-O-ethyl oxalate |
| SMILES | CCOC(=O)C(=O)Oc1cc(C)nn1-c1nc(C)cc(C)n1 |
| InChI | InChI=1S/C14H16N4O4/c1-5-21-12(19)13(20)22-11-7-10(4)17-18(11)14-15-8(2)6-9(3)16-14/h6-7H,5H2,1-4H3 |
| InChIKey | DUCJFJWHVWUSDL-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 96.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|