C13H17ClF3NO — CID 171227983
(1S)-1-[3-methoxy-5-(trifluoromethyl)phenyl]pent-4-en-1-amine;hydrochloride (PubChem CID 171227983) has the molecular formula C13H17ClF3NO and a molecular weight of 295.73 g/mol. Its IUPAC name is (1S)-1-[3-methoxy-5-(trifluoromethyl)phenyl]pent-4-en-1-amine;hydrochloride.
| Compound Name | (1S)-1-[3-methoxy-5-(trifluoromethyl)phenyl]pent-4-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171227983 |
| Molecular Formula | C13H17ClF3NO |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | (1S)-1-[3-methoxy-5-(trifluoromethyl)phenyl]pent-4-en-1-amine;hydrochloride |
| SMILES | C=CCC[C@H](N)c1cc(OC)cc(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C13H16F3NO.ClH/c1-3-4-5-12(17)9-6-10(13(14,15)16)8-11(7-9)18-2;/h3,6-8,12H,1,4-5,17H2,2H3;1H/t12-;/m0./s1 |
| InChIKey | JVQGYWPARPRKEE-YDALLXLXSA-N |
| XLogP | 4.10 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|