C11H9Cl4NS — CID 171232400
(R)-thiophen-2-yl-(2,3,6-trichlorophenyl)methanamine;hydrochloride (PubChem CID 171232400) has the molecular formula C11H9Cl4NS and a molecular weight of 329.08 g/mol. Its IUPAC name is (R)-thiophen-2-yl-(2,3,6-trichlorophenyl)methanamine;hydrochloride.
| Compound Name | (R)-thiophen-2-yl-(2,3,6-trichlorophenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171232400 |
| Molecular Formula | C11H9Cl4NS |
| Molecular Weight | 329.08 g/mol |
| Exact Mass | 326.92 |
| IUPAC Name | (R)-thiophen-2-yl-(2,3,6-trichlorophenyl)methanamine;hydrochloride |
| SMILES | Cl.N[C@@H](c1cccs1)c1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C11H8Cl3NS.ClH/c12-6-3-4-7(13)10(14)9(6)11(15)8-2-1-5-16-8;/h1-5,11H,15H2;1H/t11-;/m0./s1 |
| InChIKey | KUGYOQSEYIKMLZ-MERQFXBCSA-N |
| XLogP | 5.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.08 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|