C9H12ClNO3 — CID 171233148
ethyl (3S)-3-amino-3-(5-chlorofuran-2-yl)propanoate (PubChem CID 171233148) has the molecular formula C9H12ClNO3 and a molecular weight of 217.65 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(5-chlorofuran-2-yl)propanoate.
| Compound Name | ethyl (3S)-3-amino-3-(5-chlorofuran-2-yl)propanoate |
|---|---|
| PubChem CID | 171233148 |
| Molecular Formula | C9H12ClNO3 |
| Molecular Weight | 217.65 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | ethyl (3S)-3-amino-3-(5-chlorofuran-2-yl)propanoate |
| SMILES | CCOC(=O)C[C@H](N)c1ccc(Cl)o1 |
| InChI | InChI=1S/C9H12ClNO3/c1-2-13-9(12)5-6(11)7-3-4-8(10)14-7/h3-4,6H,2,5,11H2,1H3/t6-/m0/s1 |
| InChIKey | KNAZEPOWUJSGIC-LURJTMIESA-N |
| XLogP | 1.89 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.65 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |