C8H9Br2ClFN — CID 171235024
(1R)-1-(2,5-dibromophenyl)-2-fluoroethanamine;hydrochloride (PubChem CID 171235024) has the molecular formula C8H9Br2ClFN and a molecular weight of 333.43 g/mol. Its IUPAC name is (1R)-1-(2,5-dibromophenyl)-2-fluoroethanamine;hydrochloride.
| Compound Name | (1R)-1-(2,5-dibromophenyl)-2-fluoroethanamine;hydrochloride |
|---|---|
| PubChem CID | 171235024 |
| Molecular Formula | C8H9Br2ClFN |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 330.88 |
| IUPAC Name | (1R)-1-(2,5-dibromophenyl)-2-fluoroethanamine;hydrochloride |
| SMILES | Cl.N[C@@H](CF)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C8H8Br2FN.ClH/c9-5-1-2-7(10)6(3-5)8(12)4-11;/h1-3,8H,4,12H2;1H/t8-;/m0./s1 |
| InChIKey | LZEPZMZGAUXHAA-QRPNPIFTSA-N |
| XLogP | 3.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |