C9H7Br2N — CID 104995956
1-(2,5-dibromophenyl)prop-2-yn-1-amine (PubChem CID 104995956) has the molecular formula C9H7Br2N and a molecular weight of 288.97 g/mol. Its IUPAC name is 1-(2,5-dibromophenyl)prop-2-yn-1-amine.
| Compound Name | 1-(2,5-dibromophenyl)prop-2-yn-1-amine |
|---|---|
| PubChem CID | 104995956 |
| Molecular Formula | C9H7Br2N |
| Molecular Weight | 288.97 g/mol |
| Exact Mass | 286.89 |
| IUPAC Name | 1-(2,5-dibromophenyl)prop-2-yn-1-amine |
| SMILES | C#CC(N)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C9H7Br2N/c1-2-9(12)7-5-6(10)3-4-8(7)11/h1,3-5,9H,12H2 |
| InChIKey | XWQCUTLOLMEAKO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.97 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|