C14H20ClNO2 — CID 171236430
(S)-1,3-benzodioxol-5-yl(cyclohexyl)methanamine;hydrochloride (PubChem CID 171236430) has the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. Its IUPAC name is (S)-1,3-benzodioxol-5-yl(cyclohexyl)methanamine;hydrochloride.
| Compound Name | (S)-1,3-benzodioxol-5-yl(cyclohexyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171236430 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | (S)-1,3-benzodioxol-5-yl(cyclohexyl)methanamine;hydrochloride |
| SMILES | Cl.N[C@H](c1ccc2c(c1)OCO2)C1CCCCC1 |
| InChI | InChI=1S/C14H19NO2.ClH/c15-14(10-4-2-1-3-5-10)11-6-7-12-13(8-11)17-9-16-12;/h6-8,10,14H,1-5,9,15H2;1H/t14-;/m0./s1 |
| InChIKey | OLILRILPXPOVAD-UQKRIMTDSA-N |
| XLogP | 3.42 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |