C13H16BrNO3 — CID 171250777
(R)-(6-bromo-1,3-benzodioxol-5-yl)-(oxan-4-yl)methanamine (PubChem CID 171250777) has the molecular formula C13H16BrNO3 and a molecular weight of 314.18 g/mol. Its IUPAC name is (R)-(6-bromo-1,3-benzodioxol-5-yl)-(oxan-4-yl)methanamine.
| Compound Name | (R)-(6-bromo-1,3-benzodioxol-5-yl)-(oxan-4-yl)methanamine |
|---|---|
| PubChem CID | 171250777 |
| Molecular Formula | C13H16BrNO3 |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | (R)-(6-bromo-1,3-benzodioxol-5-yl)-(oxan-4-yl)methanamine |
| SMILES | N[C@@H](c1cc2c(cc1Br)OCO2)C1CCOCC1 |
| InChI | InChI=1S/C13H16BrNO3/c14-10-6-12-11(17-7-18-12)5-9(10)13(15)8-1-3-16-4-2-8/h5-6,8,13H,1-4,7,15H2/t13-/m1/s1 |
| InChIKey | JIGAZVAHBITTIW-CYBMUJFWSA-N |
| XLogP | 2.60 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |