C17H20FNO3 — CID 171250846
ethyl (3S)-3-amino-3-(2-ethoxynaphthalen-1-yl)-2-fluoropropanoate (PubChem CID 171250846) has the molecular formula C17H20FNO3 and a molecular weight of 305.35 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(2-ethoxynaphthalen-1-yl)-2-fluoropropanoate.
| Compound Name | ethyl (3S)-3-amino-3-(2-ethoxynaphthalen-1-yl)-2-fluoropropanoate |
|---|---|
| PubChem CID | 171250846 |
| Molecular Formula | C17H20FNO3 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | ethyl (3S)-3-amino-3-(2-ethoxynaphthalen-1-yl)-2-fluoropropanoate |
| SMILES | CCOC(=O)C(F)[C@@H](N)c1c(OCC)ccc2ccccc12 |
| InChI | InChI=1S/C17H20FNO3/c1-3-21-13-10-9-11-7-5-6-8-12(11)14(13)16(19)15(18)17(20)22-4-2/h5-10,15-16H,3-4,19H2,1-2H3/t15?,16-/m0/s1 |
| InChIKey | YMKZGFJFPZAYEW-LYKKTTPLSA-N |
| XLogP | 3.14 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |