About (3R)-3-amino-3-(5-ethylfuran-2-yl)-2,2-dimethylpropan-1-ol;hydrochloride
(3R)-3-amino-3-(5-ethylfuran-2-yl)-2,2-dimethylpropan-1-ol;hydrochloride (PubChem CID 171250896) has the molecular formula C11H20ClNO2
and a molecular weight of 233.74 g/mol. Its IUPAC name is (3R)-3-amino-3-(5-ethylfuran-2-yl)-2,2-dimethylpropan-1-ol;hydrochloride.
Molecular Properties
| Compound Name | (3R)-3-amino-3-(5-ethylfuran-2-yl)-2,2-dimethylpropan-1-ol;hydrochloride |
| PubChem CID | 171250896 |
| Molecular Formula | C11H20ClNO2 |
| Molecular Weight | 233.74 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | (3R)-3-amino-3-(5-ethylfuran-2-yl)-2,2-dimethylpropan-1-ol;hydrochloride |
| SMILES | CCc1ccc([C@H](N)C(C)(C)CO)o1.Cl |
| InChI | InChI=1S/C11H19NO2.ClH/c1-4-8-5-6-9(14-8)10(12)11(2,3)7-13;/h5-6,10,13H,4,7,12H2,1-3H3;1H/t10-;/m0./s1 |
| InChIKey | RPIPXRARFSMKBQ-PPHPATTJSA-N |
| XLogP | 2.28 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.74 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-3-amino-3-(5-ethylfuran-2-yl)-2,2-dimethylpropan-1-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-amino-3-(5-ethylfuran-2-yl)-2,2-dimethylpropan-1-ol;hydrochloride?
The IUPAC name of (3R)-3-amino-3-(5-ethylfuran-2-yl)-2,2-dimethylpropan-1-ol;hydrochloride (CID 171250896) is (3R)-3-amino-3-(5-ethylfuran-2-yl)-2,2-dimethylpropan-1-ol;hydrochloride.
What is the SMILES notation for (3R)-3-amino-3-(5-ethylfuran-2-yl)-2,2-dimethylpropan-1-ol;hydrochloride?
The canonical SMILES for (3R)-3-amino-3-(5-ethylfuran-2-yl)-2,2-dimethylpropan-1-ol;hydrochloride is CCc1ccc([C@H](N)C(C)(C)CO)o1.Cl.
What is the InChIKey of (3R)-3-amino-3-(5-ethylfuran-2-yl)-2,2-dimethylpropan-1-ol;hydrochloride?
The InChIKey is RPIPXRARFSMKBQ-PPHPATTJSA-N. The full InChI is InChI=1S/C11H19NO2.ClH/c1-4-8-5-6-9(14-8)10(12)11(2,3)7-13;/h5-6,10,13H,4,7,12H2,1-3H3;1H/t10-;/m0./s1.
What are the key properties of (3R)-3-amino-3-(5-ethylfuran-2-yl)-2,2-dimethylpropan-1-ol;hydrochloride?
(3R)-3-amino-3-(5-ethylfuran-2-yl)-2,2-dimethylpropan-1-ol;hydrochloride has a molecular weight of 233.74 g/mol, XLogP of 2.28, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-amino-3-(5-ethylfuran-2-yl)-2,2-dimethylpropan-1-ol;hydrochloride is sourced from PubChem (CID 171250896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).