C17H14N2O — CID 171252796
(4S)-4-phenanthren-9-ylimidazolidin-2-one (PubChem CID 171252796) has the molecular formula C17H14N2O and a molecular weight of 262.31 g/mol. Its IUPAC name is (4S)-4-phenanthren-9-ylimidazolidin-2-one.
| Compound Name | (4S)-4-phenanthren-9-ylimidazolidin-2-one |
|---|---|
| PubChem CID | 171252796 |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (4S)-4-phenanthren-9-ylimidazolidin-2-one |
| SMILES | O=C1NC[C@H](c2cc3ccccc3c3ccccc23)N1 |
| InChI | InChI=1S/C17H14N2O/c20-17-18-10-16(19-17)15-9-11-5-1-2-6-12(11)13-7-3-4-8-14(13)15/h1-9,16H,10H2,(H2,18,19,20)/t16-/m1/s1 |
| InChIKey | CZGOXKRNEVMCBZ-MRXNPFEDSA-N |
| XLogP | 3.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|