C11H13FN2O3 — CID 171259706
3-fluoro-4-hydroxy-5-[(2R)-piperazin-2-yl]benzoic acid (PubChem CID 171259706) has the molecular formula C11H13FN2O3 and a molecular weight of 240.23 g/mol. Its IUPAC name is 3-fluoro-4-hydroxy-5-[(2R)-piperazin-2-yl]benzoic acid.
| Compound Name | 3-fluoro-4-hydroxy-5-[(2R)-piperazin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 171259706 |
| Molecular Formula | C11H13FN2O3 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 3-fluoro-4-hydroxy-5-[(2R)-piperazin-2-yl]benzoic acid |
| SMILES | O=C(O)c1cc(F)c(O)c([C@@H]2CNCCN2)c1 |
| InChI | InChI=1S/C11H13FN2O3/c12-8-4-6(11(16)17)3-7(10(8)15)9-5-13-1-2-14-9/h3-4,9,13-15H,1-2,5H2,(H,16,17)/t9-/m0/s1 |
| InChIKey | XTFPSLXCBXDHNB-VIFPVBQESA-N |
| XLogP | 0.46 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|