C11H13BrFNO — CID 171267994
(1R,2S)-2-amino-2-(2-bromo-3-fluorophenyl)-1-cyclopropylethanol (PubChem CID 171267994) has the molecular formula C11H13BrFNO and a molecular weight of 274.13 g/mol. Its IUPAC name is (1R,2S)-2-amino-2-(2-bromo-3-fluorophenyl)-1-cyclopropylethanol.
| Compound Name | (1R,2S)-2-amino-2-(2-bromo-3-fluorophenyl)-1-cyclopropylethanol |
|---|---|
| PubChem CID | 171267994 |
| Molecular Formula | C11H13BrFNO |
| Molecular Weight | 274.13 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | (1R,2S)-2-amino-2-(2-bromo-3-fluorophenyl)-1-cyclopropylethanol |
| SMILES | N[C@@H](c1cccc(F)c1Br)[C@H](O)C1CC1 |
| InChI | InChI=1S/C11H13BrFNO/c12-9-7(2-1-3-8(9)13)10(14)11(15)6-4-5-6/h1-3,6,10-11,15H,4-5,14H2/t10-,11+/m0/s1 |
| InChIKey | KQQSPGXVXQLQDL-WDEREUQCSA-N |
| XLogP | 2.36 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.13 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |