C19H32Cl2N2O — CID 171277967
1-[(S)-oxan-4-yl-(2,4,6-trimethylphenyl)methyl]piperazine;dihydrochloride (PubChem CID 171277967) has the molecular formula C19H32Cl2N2O and a molecular weight of 375.38 g/mol. Its IUPAC name is 1-[(S)-oxan-4-yl-(2,4,6-trimethylphenyl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-oxan-4-yl-(2,4,6-trimethylphenyl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171277967 |
| Molecular Formula | C19H32Cl2N2O |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 1-[(S)-oxan-4-yl-(2,4,6-trimethylphenyl)methyl]piperazine;dihydrochloride |
| SMILES | Cc1cc(C)c([C@H](C2CCOCC2)N2CCNCC2)c(C)c1.Cl.Cl |
| InChI | InChI=1S/C19H30N2O.2ClH/c1-14-12-15(2)18(16(3)13-14)19(17-4-10-22-11-5-17)21-8-6-20-7-9-21;;/h12-13,17,19-20H,4-11H2,1-3H3;2*1H/t19-;;/m0../s1 |
| InChIKey | RBNNPTLFRVLGCL-TXEPZDRESA-N |
| XLogP | 3.83 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |