C11H13BrF3N3 — CID 171285526
1-[(1S)-1-(5-bromo-3-pyridinyl)-2,2,2-trifluoroethyl]piperazine (PubChem CID 171285526) has the molecular formula C11H13BrF3N3 and a molecular weight of 324.14 g/mol. Its IUPAC name is 1-[(1S)-1-(5-bromo-3-pyridinyl)-2,2,2-trifluoroethyl]piperazine.
| Compound Name | 1-[(1S)-1-(5-bromo-3-pyridinyl)-2,2,2-trifluoroethyl]piperazine |
|---|---|
| PubChem CID | 171285526 |
| Molecular Formula | C11H13BrF3N3 |
| Molecular Weight | 324.14 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 1-[(1S)-1-(5-bromo-3-pyridinyl)-2,2,2-trifluoroethyl]piperazine |
| SMILES | FC(F)(F)[C@H](c1cncc(Br)c1)N1CCNCC1 |
| InChI | InChI=1S/C11H13BrF3N3/c12-9-5-8(6-17-7-9)10(11(13,14)15)18-3-1-16-2-4-18/h5-7,10,16H,1-4H2/t10-/m0/s1 |
| InChIKey | GPJOWWNGUANOCE-JTQLQIEISA-N |
| XLogP | 2.35 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.14 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |