C11H13Cl2F2N3 — CID 171289999
1-[(1S)-1-(3,5-dichloro-4-pyridinyl)-2,2-difluoroethyl]piperazine (PubChem CID 171289999) has the molecular formula C11H13Cl2F2N3 and a molecular weight of 296.15 g/mol. Its IUPAC name is 1-[(1S)-1-(3,5-dichloro-4-pyridinyl)-2,2-difluoroethyl]piperazine.
| Compound Name | 1-[(1S)-1-(3,5-dichloro-4-pyridinyl)-2,2-difluoroethyl]piperazine |
|---|---|
| PubChem CID | 171289999 |
| Molecular Formula | C11H13Cl2F2N3 |
| Molecular Weight | 296.15 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 1-[(1S)-1-(3,5-dichloro-4-pyridinyl)-2,2-difluoroethyl]piperazine |
| SMILES | FC(F)[C@H](c1c(Cl)cncc1Cl)N1CCNCC1 |
| InChI | InChI=1S/C11H13Cl2F2N3/c12-7-5-17-6-8(13)9(7)10(11(14)15)18-3-1-16-2-4-18/h5-6,10-11,16H,1-4H2/t10-/m0/s1 |
| InChIKey | IRDKXGBHYLQIFC-JTQLQIEISA-N |
| XLogP | 2.60 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.15 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |