C26H23NO5 — CID 17129254
6,7-dimethoxy-2-[4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]phenyl]-3H-isoindol-1-one (PubChem CID 17129254) has the molecular formula C26H23NO5 and a molecular weight of 429.47 g/mol. Its IUPAC name is 6,7-dimethoxy-2-[4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]phenyl]-3H-isoindol-1-one.
| Compound Name | 6,7-dimethoxy-2-[4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]phenyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 17129254 |
| Molecular Formula | C26H23NO5 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 6,7-dimethoxy-2-[4-[(E)-3-(4-methoxyphenyl)prop-2-enoyl]phenyl]-3H-isoindol-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(N3Cc4ccc(OC)c(OC)c4C3=O)cc2)cc1 |
| InChI | InChI=1S/C26H23NO5/c1-30-21-12-4-17(5-13-21)6-14-22(28)18-7-10-20(11-8-18)27-16-19-9-15-23(31-2)25(32-3)24(19)26(27)29/h4-15H,16H2,1-3H3/b14-6+ |
| InChIKey | FMYOMTWGAPODPH-MKMNVTDBSA-N |
| XLogP | 4.77 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|