C16H29Cl2N3O — CID 171300547
6-amino-3-methyl-2-[(1R)-3-methyl-1-piperazin-1-ylbutyl]phenol;dihydrochloride (PubChem CID 171300547) has the molecular formula C16H29Cl2N3O and a molecular weight of 350.33 g/mol. Its IUPAC name is 6-amino-3-methyl-2-[(1R)-3-methyl-1-piperazin-1-ylbutyl]phenol;dihydrochloride.
| Compound Name | 6-amino-3-methyl-2-[(1R)-3-methyl-1-piperazin-1-ylbutyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 171300547 |
| Molecular Formula | C16H29Cl2N3O |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 6-amino-3-methyl-2-[(1R)-3-methyl-1-piperazin-1-ylbutyl]phenol;dihydrochloride |
| SMILES | Cc1ccc(N)c(O)c1[C@@H](CC(C)C)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H27N3O.2ClH/c1-11(2)10-14(19-8-6-18-7-9-19)15-12(3)4-5-13(17)16(15)20;;/h4-5,11,14,18,20H,6-10,17H2,1-3H3;2*1H/t14-;;/m1../s1 |
| InChIKey | XQPYGXMKHVRUSH-FMOMHUKBSA-N |
| XLogP | 3.12 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|