C14H17F3N2O — CID 171301248
2-[(R)-cyclopropyl(piperazin-1-yl)methyl]-3,4,5-trifluorophenol (PubChem CID 171301248) has the molecular formula C14H17F3N2O and a molecular weight of 286.30 g/mol. Its IUPAC name is 2-[(R)-cyclopropyl(piperazin-1-yl)methyl]-3,4,5-trifluorophenol.
| Compound Name | 2-[(R)-cyclopropyl(piperazin-1-yl)methyl]-3,4,5-trifluorophenol |
|---|---|
| PubChem CID | 171301248 |
| Molecular Formula | C14H17F3N2O |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 2-[(R)-cyclopropyl(piperazin-1-yl)methyl]-3,4,5-trifluorophenol |
| SMILES | Oc1cc(F)c(F)c(F)c1[C@@H](C1CC1)N1CCNCC1 |
| InChI | InChI=1S/C14H17F3N2O/c15-9-7-10(20)11(13(17)12(9)16)14(8-1-2-8)19-5-3-18-4-6-19/h7-8,14,18,20H,1-6H2/t14-/m1/s1 |
| InChIKey | ASWHRPYRXCPPII-CQSZACIVSA-N |
| XLogP | 2.17 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|