C16H29Cl2N3O2 — CID 171309268
5-(hydroxymethyl)-2-methyl-4-[(1S)-1-piperazin-1-ylpentyl]pyridin-3-ol;dihydrochloride (PubChem CID 171309268) has the molecular formula C16H29Cl2N3O2 and a molecular weight of 366.33 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2-methyl-4-[(1S)-1-piperazin-1-ylpentyl]pyridin-3-ol;dihydrochloride.
| Compound Name | 5-(hydroxymethyl)-2-methyl-4-[(1S)-1-piperazin-1-ylpentyl]pyridin-3-ol;dihydrochloride |
|---|---|
| PubChem CID | 171309268 |
| Molecular Formula | C16H29Cl2N3O2 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 5-(hydroxymethyl)-2-methyl-4-[(1S)-1-piperazin-1-ylpentyl]pyridin-3-ol;dihydrochloride |
| SMILES | CCCC[C@@H](c1c(CO)cnc(C)c1O)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H27N3O2.2ClH/c1-3-4-5-14(19-8-6-17-7-9-19)15-13(11-20)10-18-12(2)16(15)21;;/h10,14,17,20-21H,3-9,11H2,1-2H3;2*1H/t14-;;/m0../s1 |
| InChIKey | GYSYGCDCQTWRHM-UTLKBRERSA-N |
| XLogP | 2.57 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |