C10H8F7NO — CID 171311871
(1S)-1-[2-(difluoromethoxy)phenyl]-2,2,3,3,3-pentafluoropropan-1-amine (PubChem CID 171311871) has the molecular formula C10H8F7NO and a molecular weight of 291.17 g/mol. Its IUPAC name is (1S)-1-[2-(difluoromethoxy)phenyl]-2,2,3,3,3-pentafluoropropan-1-amine.
| Compound Name | (1S)-1-[2-(difluoromethoxy)phenyl]-2,2,3,3,3-pentafluoropropan-1-amine |
|---|---|
| PubChem CID | 171311871 |
| Molecular Formula | C10H8F7NO |
| Molecular Weight | 291.17 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | (1S)-1-[2-(difluoromethoxy)phenyl]-2,2,3,3,3-pentafluoropropan-1-amine |
| SMILES | N[C@@H](c1ccccc1OC(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H8F7NO/c11-8(12)19-6-4-2-1-3-5(6)7(18)9(13,14)10(15,16)17/h1-4,7-8H,18H2/t7-/m0/s1 |
| InChIKey | RWCDTWCZNKIQSJ-ZETCQYMHSA-N |
| XLogP | 3.49 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.17 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|