C14H12F5NO — CID 171311917
(1S)-2,2,3,3,3-pentafluoro-1-(2-methoxynaphthalen-1-yl)propan-1-amine (PubChem CID 171311917) has the molecular formula C14H12F5NO and a molecular weight of 305.25 g/mol. Its IUPAC name is (1S)-2,2,3,3,3-pentafluoro-1-(2-methoxynaphthalen-1-yl)propan-1-amine.
| Compound Name | (1S)-2,2,3,3,3-pentafluoro-1-(2-methoxynaphthalen-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 171311917 |
| Molecular Formula | C14H12F5NO |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | (1S)-2,2,3,3,3-pentafluoro-1-(2-methoxynaphthalen-1-yl)propan-1-amine |
| SMILES | COc1ccc2ccccc2c1[C@H](N)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H12F5NO/c1-21-10-7-6-8-4-2-3-5-9(8)11(10)12(20)13(15,16)14(17,18)19/h2-7,12H,20H2,1H3/t12-/m0/s1 |
| InChIKey | LFOGFRVGBUPQRM-LBPRGKRZSA-N |
| XLogP | 4.05 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|