C34H35N6O7P — CID 171314881
3-[amino-[2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(6-oxo-1H-purin-9-yl)oxolan-3-yl]oxyphosphanyl]oxypropanenitrile (PubChem CID 171314881) has the molecular formula C34H35N6O7P and a molecular weight of 670.66 g/mol. Its IUPAC name is 3-[amino-[2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(6-oxo-1H-purin-9-yl)oxolan-3-yl]oxyphosphanyl]oxypropanenitrile.
| Compound Name | 3-[amino-[2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(6-oxo-1H-purin-9-yl)oxolan-3-yl]oxyphosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 171314881 |
| Molecular Formula | C34H35N6O7P |
| Molecular Weight | 670.66 g/mol |
| Exact Mass | 670.23 |
| IUPAC Name | 3-[amino-[2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(6-oxo-1H-purin-9-yl)oxolan-3-yl]oxyphosphanyl]oxypropanenitrile |
| SMILES | COc1ccc(C(OCC2OC(n3cnc4c(=O)[nH]cnc43)CC2OP(N)OCCC#N)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C34H35N6O7P/c1-42-26-13-9-24(10-14-26)34(23-7-4-3-5-8-23,25-11-15-27(43-2)16-12-25)44-20-29-28(47-48(36)45-18-6-17-35)19-30(46-29)40-22-39-31-32(40)37-21-38-33(31)41/h3-5,7-16,21-22,28-30H,6,18-20,36H2,1-2H3,(H,37,38,41) |
| InChIKey | PDABLPHXKJRZJQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 168.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.66 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|