C16H19F2N3O — CID 171315003
4-(difluoromethyl)-6-(3,4-dimethylphenyl)-N-(2-methoxyethyl)pyrimidin-2-amine (PubChem CID 171315003) has the molecular formula C16H19F2N3O and a molecular weight of 307.34 g/mol. Its IUPAC name is 4-(difluoromethyl)-6-(3,4-dimethylphenyl)-N-(2-methoxyethyl)pyrimidin-2-amine.
| Compound Name | 4-(difluoromethyl)-6-(3,4-dimethylphenyl)-N-(2-methoxyethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 171315003 |
| Molecular Formula | C16H19F2N3O |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 4-(difluoromethyl)-6-(3,4-dimethylphenyl)-N-(2-methoxyethyl)pyrimidin-2-amine |
| SMILES | COCCNc1nc(-c2ccc(C)c(C)c2)cc(C(F)F)n1 |
| InChI | InChI=1S/C16H19F2N3O/c1-10-4-5-12(8-11(10)2)13-9-14(15(17)18)21-16(20-13)19-6-7-22-3/h4-5,8-9,15H,6-7H2,1-3H3,(H,19,20,21) |
| InChIKey | SWOWCWLKECAWAT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|