C27H30F2N2O4 — CID 171316506
2-[[2-(cyclohexylamino)-1-(4-fluorophenyl)-2-oxoethyl]-methylamino]ethyl 4-(4-fluorophenyl)-4-oxobut-2-enoate (PubChem CID 171316506) has the molecular formula C27H30F2N2O4 and a molecular weight of 484.54 g/mol. Its IUPAC name is 2-[[2-(cyclohexylamino)-1-(4-fluorophenyl)-2-oxoethyl]-methylamino]ethyl 4-(4-fluorophenyl)-4-oxobut-2-enoate.
| Compound Name | 2-[[2-(cyclohexylamino)-1-(4-fluorophenyl)-2-oxoethyl]-methylamino]ethyl 4-(4-fluorophenyl)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 171316506 |
| Molecular Formula | C27H30F2N2O4 |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | 2-[[2-(cyclohexylamino)-1-(4-fluorophenyl)-2-oxoethyl]-methylamino]ethyl 4-(4-fluorophenyl)-4-oxobut-2-enoate |
| SMILES | CN(CCOC(=O)C=CC(=O)c1ccc(F)cc1)C(C(=O)NC1CCCCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H30F2N2O4/c1-31(17-18-35-25(33)16-15-24(32)19-7-11-21(28)12-8-19)26(20-9-13-22(29)14-10-20)27(34)30-23-5-3-2-4-6-23/h7-16,23,26H,2-6,17-18H2,1H3,(H,30,34) |
| InChIKey | VSQAGUQSBCIOIV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|