C23H33N5O4 — CID 171316666
1-[(5R)-5-benzyl-3-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propan-1-one;formic acid (PubChem CID 171316666) has the molecular formula C23H33N5O4 and a molecular weight of 443.55 g/mol. Its IUPAC name is 1-[(5R)-5-benzyl-3-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propan-1-one;formic acid.
| Compound Name | 1-[(5R)-5-benzyl-3-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propan-1-one;formic acid |
|---|---|
| PubChem CID | 171316666 |
| Molecular Formula | C23H33N5O4 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 1-[(5R)-5-benzyl-3-methyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propan-1-one;formic acid |
| SMILES | Cc1nnc2n1[C@H](Cc1ccccc1)CN(C(=O)CCN1C[C@@H](C)O[C@@H](C)C1)C2.O=CO |
| InChI | InChI=1S/C22H31N5O2.CH2O2/c1-16-12-25(13-17(2)29-16)10-9-22(28)26-14-20(11-19-7-5-4-6-8-19)27-18(3)23-24-21(27)15-26;2-1-3/h4-8,16-17,20H,9-15H2,1-3H3;1H,(H,2,3)/t16-,17+,20-;/m1./s1 |
| InChIKey | VVLNSJLONJCDHJ-VYZBTARASA-N |
| XLogP | 1.91 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|