C21H28ClN3O7 — CID 171317052
7-chloro-3-[4-[(dimethylamino)methyl]-4-methoxypiperidine-1-carbonyl]-1H-quinolin-4-one;formic acid (PubChem CID 171317052) has the molecular formula C21H28ClN3O7 and a molecular weight of 469.92 g/mol. Its IUPAC name is 7-chloro-3-[4-[(dimethylamino)methyl]-4-methoxypiperidine-1-carbonyl]-1H-quinolin-4-one;formic acid.
| Compound Name | 7-chloro-3-[4-[(dimethylamino)methyl]-4-methoxypiperidine-1-carbonyl]-1H-quinolin-4-one;formic acid |
|---|---|
| PubChem CID | 171317052 |
| Molecular Formula | C21H28ClN3O7 |
| Molecular Weight | 469.92 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 7-chloro-3-[4-[(dimethylamino)methyl]-4-methoxypiperidine-1-carbonyl]-1H-quinolin-4-one;formic acid |
| SMILES | COC1(CN(C)C)CCN(C(=O)c2c[nH]c3cc(Cl)ccc3c2=O)CC1.O=CO.O=CO |
| InChI | InChI=1S/C19H24ClN3O3.2CH2O2/c1-22(2)12-19(26-3)6-8-23(9-7-19)18(25)15-11-21-16-10-13(20)4-5-14(16)17(15)24;2*2-1-3/h4-5,10-11H,6-9,12H2,1-3H3,(H,21,24);2*1H,(H,2,3) |
| InChIKey | XQQBORGJJJCXMM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 140.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.92 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|