C17H21N3O4 — CID 138001661
3-[4-(aminomethyl)-4-hydroxypiperidine-1-carbonyl]-7-methoxy-1H-quinolin-4-one (PubChem CID 138001661) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is 3-[4-(aminomethyl)-4-hydroxypiperidine-1-carbonyl]-7-methoxy-1H-quinolin-4-one.
| Compound Name | 3-[4-(aminomethyl)-4-hydroxypiperidine-1-carbonyl]-7-methoxy-1H-quinolin-4-one |
|---|---|
| PubChem CID | 138001661 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 3-[4-(aminomethyl)-4-hydroxypiperidine-1-carbonyl]-7-methoxy-1H-quinolin-4-one |
| SMILES | COc1ccc2c(=O)c(C(=O)N3CCC(O)(CN)CC3)c[nH]c2c1 |
| InChI | InChI=1S/C17H21N3O4/c1-24-11-2-3-12-14(8-11)19-9-13(15(12)21)16(22)20-6-4-17(23,10-18)5-7-20/h2-3,8-9,23H,4-7,10,18H2,1H3,(H,19,21) |
| InChIKey | MAGKAQHMVUBYQA-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |