C21H29FN4O3 — CID 171317322
3-[2-[(4-fluorophenyl)methyl]-5-methyl-1,2,4-triazol-3-yl]-1-(oxan-4-yl)piperidine;formic acid (PubChem CID 171317322) has the molecular formula C21H29FN4O3 and a molecular weight of 404.49 g/mol. Its IUPAC name is 3-[2-[(4-fluorophenyl)methyl]-5-methyl-1,2,4-triazol-3-yl]-1-(oxan-4-yl)piperidine;formic acid.
| Compound Name | 3-[2-[(4-fluorophenyl)methyl]-5-methyl-1,2,4-triazol-3-yl]-1-(oxan-4-yl)piperidine;formic acid |
|---|---|
| PubChem CID | 171317322 |
| Molecular Formula | C21H29FN4O3 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 3-[2-[(4-fluorophenyl)methyl]-5-methyl-1,2,4-triazol-3-yl]-1-(oxan-4-yl)piperidine;formic acid |
| SMILES | Cc1nc(C2CCCN(C3CCOCC3)C2)n(Cc2ccc(F)cc2)n1.O=CO |
| InChI | InChI=1S/C20H27FN4O.CH2O2/c1-15-22-20(25(23-15)13-16-4-6-18(21)7-5-16)17-3-2-10-24(14-17)19-8-11-26-12-9-19;2-1-3/h4-7,17,19H,2-3,8-14H2,1H3;1H,(H,2,3) |
| InChIKey | KYLGIOAVDREVBA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|