C16H25F3N4O3 — CID 166598801
formic acid;3-[5-methyl-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-1-(oxan-4-yl)piperidine (PubChem CID 166598801) has the molecular formula C16H25F3N4O3 and a molecular weight of 378.40 g/mol. Its IUPAC name is formic acid;3-[5-methyl-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-1-(oxan-4-yl)piperidine.
| Compound Name | formic acid;3-[5-methyl-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-1-(oxan-4-yl)piperidine |
|---|---|
| PubChem CID | 166598801 |
| Molecular Formula | C16H25F3N4O3 |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | formic acid;3-[5-methyl-2-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]-1-(oxan-4-yl)piperidine |
| SMILES | Cc1nc(C2CCCN(C3CCOCC3)C2)n(CC(F)(F)F)n1.O=CO |
| InChI | InChI=1S/C15H23F3N4O.CH2O2/c1-11-19-14(22(20-11)10-15(16,17)18)12-3-2-6-21(9-12)13-4-7-23-8-5-13;2-1-3/h12-13H,2-10H2,1H3;1H,(H,2,3) |
| InChIKey | DJCYOBYMDHXARX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|