C22H29NO2 — CID 171318057
4-[[(2R,4S)-4-benzyl-1-(3-hydroxypropyl)piperidin-2-yl]methyl]phenol (PubChem CID 171318057) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is 4-[[(2R,4S)-4-benzyl-1-(3-hydroxypropyl)piperidin-2-yl]methyl]phenol.
| Compound Name | 4-[[(2R,4S)-4-benzyl-1-(3-hydroxypropyl)piperidin-2-yl]methyl]phenol |
|---|---|
| PubChem CID | 171318057 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 4-[[(2R,4S)-4-benzyl-1-(3-hydroxypropyl)piperidin-2-yl]methyl]phenol |
| SMILES | OCCCN1CC[C@H](Cc2ccccc2)C[C@@H]1Cc1ccc(O)cc1 |
| InChI | InChI=1S/C22H29NO2/c24-14-4-12-23-13-11-20(15-18-5-2-1-3-6-18)17-21(23)16-19-7-9-22(25)10-8-19/h1-3,5-10,20-21,24-25H,4,11-17H2/t20-,21+/m1/s1 |
| InChIKey | SIYNZLKFXPAKEL-RTWAWAEBSA-N |
| XLogP | 3.64 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |