C24H29ClN2O3 — CID 171318206
2-[4-(2-methoxyphenyl)-2-(naphthalen-1-yloxymethyl)piperazin-1-yl]ethanol;hydrochloride (PubChem CID 171318206) has the molecular formula C24H29ClN2O3 and a molecular weight of 428.96 g/mol. Its IUPAC name is 2-[4-(2-methoxyphenyl)-2-(naphthalen-1-yloxymethyl)piperazin-1-yl]ethanol;hydrochloride.
| Compound Name | 2-[4-(2-methoxyphenyl)-2-(naphthalen-1-yloxymethyl)piperazin-1-yl]ethanol;hydrochloride |
|---|---|
| PubChem CID | 171318206 |
| Molecular Formula | C24H29ClN2O3 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 2-[4-(2-methoxyphenyl)-2-(naphthalen-1-yloxymethyl)piperazin-1-yl]ethanol;hydrochloride |
| SMILES | COc1ccccc1N1CCN(CCO)C(COc2cccc3ccccc23)C1.Cl |
| InChI | InChI=1S/C24H28N2O3.ClH/c1-28-24-11-5-4-10-22(24)26-14-13-25(15-16-27)20(17-26)18-29-23-12-6-8-19-7-2-3-9-21(19)23;/h2-12,20,27H,13-18H2,1H3;1H |
| InChIKey | UEIVEZMRWUTVIT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |