C20H28N4O — CID 56897135
4-[[4-(2-methoxyphenyl)-2-methylpiperazin-1-yl]methyl]-2-propan-2-ylpyrimidine (PubChem CID 56897135) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is 4-[[4-(2-methoxyphenyl)-2-methylpiperazin-1-yl]methyl]-2-propan-2-ylpyrimidine.
| Compound Name | 4-[[4-(2-methoxyphenyl)-2-methylpiperazin-1-yl]methyl]-2-propan-2-ylpyrimidine |
|---|---|
| PubChem CID | 56897135 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | 4-[[4-(2-methoxyphenyl)-2-methylpiperazin-1-yl]methyl]-2-propan-2-ylpyrimidine |
| SMILES | COc1ccccc1N1CCN(Cc2ccnc(C(C)C)n2)C(C)C1 |
| InChI | InChI=1S/C20H28N4O/c1-15(2)20-21-10-9-17(22-20)14-23-11-12-24(13-16(23)3)18-7-5-6-8-19(18)25-4/h5-10,15-16H,11-14H2,1-4H3 |
| InChIKey | RZPGKMAYDDFONC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |