C20H30N4O — CID 56909683
1-[(2-butyl-1H-imidazol-5-yl)methyl]-4-(2-methoxyphenyl)-2-methylpiperazine (PubChem CID 56909683) has the molecular formula C20H30N4O and a molecular weight of 342.49 g/mol. Its IUPAC name is 1-[(2-butyl-1H-imidazol-5-yl)methyl]-4-(2-methoxyphenyl)-2-methylpiperazine.
| Compound Name | 1-[(2-butyl-1H-imidazol-5-yl)methyl]-4-(2-methoxyphenyl)-2-methylpiperazine |
|---|---|
| PubChem CID | 56909683 |
| Molecular Formula | C20H30N4O |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 1-[(2-butyl-1H-imidazol-5-yl)methyl]-4-(2-methoxyphenyl)-2-methylpiperazine |
| SMILES | CCCCc1ncc(CN2CCN(c3ccccc3OC)CC2C)[nH]1 |
| InChI | InChI=1S/C20H30N4O/c1-4-5-10-20-21-13-17(22-20)15-23-11-12-24(14-16(23)2)18-8-6-7-9-19(18)25-3/h6-9,13,16H,4-5,10-12,14-15H2,1-3H3,(H,21,22) |
| InChIKey | HWTQPSLPEYEYCS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |