C17H26N6O — CID 154929747
1-(1-butyltetrazol-5-yl)-4-(2-methoxyphenyl)-2-methylpiperazine (PubChem CID 154929747) has the molecular formula C17H26N6O and a molecular weight of 330.44 g/mol. Its IUPAC name is 1-(1-butyltetrazol-5-yl)-4-(2-methoxyphenyl)-2-methylpiperazine.
| Compound Name | 1-(1-butyltetrazol-5-yl)-4-(2-methoxyphenyl)-2-methylpiperazine |
|---|---|
| PubChem CID | 154929747 |
| Molecular Formula | C17H26N6O |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 1-(1-butyltetrazol-5-yl)-4-(2-methoxyphenyl)-2-methylpiperazine |
| SMILES | CCCCn1nnnc1N1CCN(c2ccccc2OC)CC1C |
| InChI | InChI=1S/C17H26N6O/c1-4-5-10-23-17(18-19-20-23)22-12-11-21(13-14(22)2)15-8-6-7-9-16(15)24-3/h6-9,14H,4-5,10-13H2,1-3H3 |
| InChIKey | KRINCXPZZACDBW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |