C16H22O4 — CID 171319726
(2R)-2-[(4aS,8aS)-7-methoxycarbonyl-4-methylidene-2,3,4a,5,6,8a-hexahydro-1H-naphthalen-1-yl]propanoic acid (PubChem CID 171319726) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is (2R)-2-[(4aS,8aS)-7-methoxycarbonyl-4-methylidene-2,3,4a,5,6,8a-hexahydro-1H-naphthalen-1-yl]propanoic acid.
| Compound Name | (2R)-2-[(4aS,8aS)-7-methoxycarbonyl-4-methylidene-2,3,4a,5,6,8a-hexahydro-1H-naphthalen-1-yl]propanoic acid |
|---|---|
| PubChem CID | 171319726 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (2R)-2-[(4aS,8aS)-7-methoxycarbonyl-4-methylidene-2,3,4a,5,6,8a-hexahydro-1H-naphthalen-1-yl]propanoic acid |
| SMILES | C=C1CCC([C@@H](C)C(=O)O)[C@H]2C=C(C(=O)OC)CC[C@H]12 |
| InChI | InChI=1S/C16H22O4/c1-9-4-6-13(10(2)15(17)18)14-8-11(16(19)20-3)5-7-12(9)14/h8,10,12-14H,1,4-7H2,2-3H3,(H,17,18)/t10-,12-,13?,14+/m1/s1 |
| InChIKey | QSWDROZZIFWYRS-SULVTUCISA-N |
| XLogP | 2.80 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|