C16H24O3 — CID 162860675
methyl (8R,8aS)-8-[(2S)-1-hydroxypropan-2-yl]-5-methyl-3,4,6,7,8,8a-hexahydronaphthalene-2-carboxylate (PubChem CID 162860675) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is methyl (8R,8aS)-8-[(2S)-1-hydroxypropan-2-yl]-5-methyl-3,4,6,7,8,8a-hexahydronaphthalene-2-carboxylate.
| Compound Name | methyl (8R,8aS)-8-[(2S)-1-hydroxypropan-2-yl]-5-methyl-3,4,6,7,8,8a-hexahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 162860675 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | methyl (8R,8aS)-8-[(2S)-1-hydroxypropan-2-yl]-5-methyl-3,4,6,7,8,8a-hexahydronaphthalene-2-carboxylate |
| SMILES | COC(=O)C1=C[C@H]2C(=C(C)CC[C@H]2[C@H](C)CO)CC1 |
| InChI | InChI=1S/C16H24O3/c1-10-4-6-14(11(2)9-17)15-8-12(16(18)19-3)5-7-13(10)15/h8,11,14-15,17H,4-7,9H2,1-3H3/t11-,14+,15+/m1/s1 |
| InChIKey | XRCMEOXEWNTAPL-UGFHNGPFSA-N |
| XLogP | 2.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|