C18H26IN3O3 — CID 171320794
tert-butyl 2-[[(3S)-1-[(2-iodophenyl)carbamoyl]piperidin-3-yl]amino]acetate (PubChem CID 171320794) has the molecular formula C18H26IN3O3 and a molecular weight of 459.33 g/mol. Its IUPAC name is tert-butyl 2-[[(3S)-1-[(2-iodophenyl)carbamoyl]piperidin-3-yl]amino]acetate.
| Compound Name | tert-butyl 2-[[(3S)-1-[(2-iodophenyl)carbamoyl]piperidin-3-yl]amino]acetate |
|---|---|
| PubChem CID | 171320794 |
| Molecular Formula | C18H26IN3O3 |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | tert-butyl 2-[[(3S)-1-[(2-iodophenyl)carbamoyl]piperidin-3-yl]amino]acetate |
| SMILES | CC(C)(C)OC(=O)CN[C@H]1CCCN(C(=O)Nc2ccccc2I)C1 |
| InChI | InChI=1S/C18H26IN3O3/c1-18(2,3)25-16(23)11-20-13-7-6-10-22(12-13)17(24)21-15-9-5-4-8-14(15)19/h4-5,8-9,13,20H,6-7,10-12H2,1-3H3,(H,21,24)/t13-/m0/s1 |
| InChIKey | IGMBCFLXPPSMOA-ZDUSSCGKSA-N |
| XLogP | 3.22 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|