C21H28N6O4 — CID 171321549
N-[2-(4-benzylpiperazin-1-yl)ethyl]-5H-pyrrolo[3,2-d]pyrimidin-4-amine;formic acid (PubChem CID 171321549) has the molecular formula C21H28N6O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-[2-(4-benzylpiperazin-1-yl)ethyl]-5H-pyrrolo[3,2-d]pyrimidin-4-amine;formic acid.
| Compound Name | N-[2-(4-benzylpiperazin-1-yl)ethyl]-5H-pyrrolo[3,2-d]pyrimidin-4-amine;formic acid |
|---|---|
| PubChem CID | 171321549 |
| Molecular Formula | C21H28N6O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | N-[2-(4-benzylpiperazin-1-yl)ethyl]-5H-pyrrolo[3,2-d]pyrimidin-4-amine;formic acid |
| SMILES | O=CO.O=CO.c1ccc(CN2CCN(CCNc3ncnc4cc[nH]c34)CC2)cc1 |
| InChI | InChI=1S/C19H24N6.2CH2O2/c1-2-4-16(5-3-1)14-25-12-10-24(11-13-25)9-8-21-19-18-17(6-7-20-18)22-15-23-19;2*2-1-3/h1-7,15,20H,8-14H2,(H,21,22,23);2*1H,(H,2,3) |
| InChIKey | RZIUMKBQOZDJFH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 134.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|