C20H28ClFN2O3 — CID 171321595
9-[(3-chloro-2-fluorophenyl)methyl]-2-(3-methylbut-2-enyl)-6-oxa-2,9-diazaspiro[4.5]decane;formic acid (PubChem CID 171321595) has the molecular formula C20H28ClFN2O3 and a molecular weight of 398.91 g/mol. Its IUPAC name is 9-[(3-chloro-2-fluorophenyl)methyl]-2-(3-methylbut-2-enyl)-6-oxa-2,9-diazaspiro[4.5]decane;formic acid.
| Compound Name | 9-[(3-chloro-2-fluorophenyl)methyl]-2-(3-methylbut-2-enyl)-6-oxa-2,9-diazaspiro[4.5]decane;formic acid |
|---|---|
| PubChem CID | 171321595 |
| Molecular Formula | C20H28ClFN2O3 |
| Molecular Weight | 398.91 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 9-[(3-chloro-2-fluorophenyl)methyl]-2-(3-methylbut-2-enyl)-6-oxa-2,9-diazaspiro[4.5]decane;formic acid |
| SMILES | CC(C)=CCN1CCC2(C1)CN(Cc1cccc(Cl)c1F)CCO2.O=CO |
| InChI | InChI=1S/C19H26ClFN2O.CH2O2/c1-15(2)6-8-22-9-7-19(13-22)14-23(10-11-24-19)12-16-4-3-5-17(20)18(16)21;2-1-3/h3-6H,7-14H2,1-2H3;1H,(H,2,3) |
| InChIKey | GSTVLZCXBUGJFS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.91 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|